cas: 1004294-77-2 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanone 97% (CAS 1004294-77-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A544660-250mg |
| cas | 1004294-77-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2078.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A544660 |
2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 1004294-77-2) is a chemical compound with the molecular formula C14H16BF3O3 and a molecular weight of 300.08 g/mol. IUPAC name: 2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: PDKVUFXTFXPSGZ-UHFFFAOYSA-N.
| Molecular formula | C14H16BF3O3 |
|---|---|
| Molecular weight | 300.08 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | PDKVUFXTFXPSGZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)