cas: 74853-66-0 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethanone 96% (CAS 74853-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A699974-100mg |
| cas | 74853-66-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 637.38 Pln | |
| Ambeed | 25g | 1583.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A699974 |
2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanone (CAS 74853-66-0) is a chemical compound with the molecular formula C9H4F6O and a molecular weight of 242.12 g/mol. IUPAC name: 2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanone. InChIKey: ZERSWRKHUIMRSN-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanone |
| InChIKey | ZERSWRKHUIMRSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)