cas: 1800-42-6 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(naphthalen-2-yl)ethanone 98% (CAS 1800-42-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A612576-100mg |
| cas | 1800-42-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 915.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A612576 |
2,2,2-trifluoro-1-naphthalen-2-ylethanone (CAS 1800-42-6) is a chemical compound with the molecular formula C12H7F3O and a molecular weight of 224.18 g/mol. IUPAC name: 2,2,2-trifluoro-1-naphthalen-2-ylethanone. InChIKey: JWQLBVFFLIHXHA-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-naphthalen-2-ylethanone |
| InChIKey | JWQLBVFFLIHXHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)