cas: 434-45-7 — see every product listed under this CAS number, including other names
2,2,2-Trifluoroacetophenone, >98.0%(GC) (CAS 434-45-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0848-5G |
| cas | 434-45-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 198.51 Pln | |
| TCI | 25g | 464.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,2,2-trifluoro-1-phenylethanone (CAS 434-45-7) is a chemical compound with the molecular formula C8H5F3O and a molecular weight of 174.12 g/mol. IUPAC name: 2,2,2-trifluoro-1-phenylethanone. InChIKey: KZJRKRQSDZGHEC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O |
|---|---|
| Molecular weight | 174.12 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-phenylethanone |
| InChIKey | KZJRKRQSDZGHEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)