2,2,3,3,4,4,4-Heptafluorobutanal hydrate, 95%
cas: 907607-07-2 — see every product listed under this CAS number, including other names
2,2,3,3,4,4,4-Heptafluorobutanal hydrate, 95% (CAS 907607-07-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A295363-100mg |
| cas | 907607-07-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1610.81 Pln | |
| Ambeed | 5g | 3941.50 Pln | |
| Ambeed | 25g | 13625.81 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1730.53 Pln | |
| BLDpharm | 5g | 4246.31 Pln | |
| BLDpharm | 25g | 14687.08 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,2,3,3,4,4,4-heptafluorobutanal;hydrate (CAS 907607-07-2) is a chemical compound with the molecular formula C4H3F7O2 and a molecular weight of 216.05 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptafluorobutanal;hydrate. InChIKey: SIFCGDJQLNEASB-UHFFFAOYSA-N.
| Molecular formula | C4H3F7O2 |
|---|---|
| Molecular weight | 216.05 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptafluorobutanal;hydrate |
| InChIKey | SIFCGDJQLNEASB-UHFFFAOYSA-N |
| SMILES | C(=O)C(C(C(F)(F)F)(F)F)(F)F.O |
Computed by PubChem (NCBI)
Synonyms:
2,2,3,3,4,4,4-Heptafluorobutanal--water (1/1), Heptafluorobutyraldehyde hydrate, 2,2,3,3,4,4,4-heptafluorobutanal hydrate, Butanal, 2,2,3,3,4,4,4-heptafluoro-, monohydrate, 2,2,3,3,4,4,4-heptafluorobutanal;hydrate, 2,2,3,3,4,4,4-Heptafluorobutanal xhydrate, perfluorobutanal hydrate, 2,2,3,3,4,4,4-heptafluorobutanal, hydrate, Heptafluorobutanal hydrate; Heptafluorobutan-1,1-diol