cas: 182499-80-5 — see every product listed under this CAS number, including other names
2,2′-Dithiobis[4-bromobenzenamine], 97%, 97% (CAS 182499-80-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134XH-100mg |
| cas | 182499-80-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1485.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[(2-amino-5-bromophenyl)disulfanyl]-4-bromoaniline (CAS 182499-80-5) is a chemical compound with the molecular formula C12H10Br2N2S2 and a molecular weight of 406.2 g/mol. IUPAC name: 2-[(2-amino-5-bromophenyl)disulfanyl]-4-bromoaniline. InChIKey: PJIQDIIKISUDNK-UHFFFAOYSA-N.
| Molecular formula | C12H10Br2N2S2 |
|---|---|
| Molecular weight | 406.2 g/mol |
| IUPAC name | 2-[(2-amino-5-bromophenyl)disulfanyl]-4-bromoaniline |
| InChIKey | PJIQDIIKISUDNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)SSC2=C(C=CC(=C2)Br)N)N |
Computed by PubChem (NCBI)