Products 5365-14-0

CAS 5365-14-0 appears in our catalog under these names: 2,2-Dichlorocyclopropane-1-carboxylic acid, 95%, 2,2-Dichlorocyclopropane-1-carboxylic acid, 2,2-Dichloro-cyclopropanecarboxylicacid, 98%, 98%, 2,2-Dichlorocyclopropane-1-carboxylic acid, 98%, 2,2-Dichlorocyclopropanecarboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g.

Structural formula: {0} (CAS {1})

2,2-dichlorocyclopropane-1-carboxylic acid (CAS 5365-14-0) is a chemical compound with the molecular formula C4H4Cl2O2 and a molecular weight of 154.98 g/mol. IUPAC name: 2,2-dichlorocyclopropane-1-carboxylic acid. InChIKey: GVGFEJPTKINGLP-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4Cl2O2
Molecular weight154.98 g/mol
IUPAC name2,2-dichlorocyclopropane-1-carboxylic acid
InChIKeyGVGFEJPTKINGLP-UHFFFAOYSA-N
SMILESC1C(C1(Cl)Cl)C(=O)O

Computed by PubChem (NCBI)