2,2-Dimethyl-1-(7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-1-yl)propan-1-one, 98%
cas: 2376879-92-2 — see every product listed under this CAS number, including other names
2,2-Dimethyl-1-(7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-1-yl)propan-1-one, 98% (CAS 2376879-92-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1390027-250mg |
| cas | 2376879-92-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 954.44 Pln | |
| Ambeed | 25g | 3168.31 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 319.91 Pln | |
| BLDpharm | 5g | 936.36 Pln | |
| BLDpharm | 25g | 3107.82 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1019.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,2-dimethyl-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]propan-1-one (CAS 2376879-92-2) is a chemical compound with the molecular formula C19H26BNO3 and a molecular weight of 327.2 g/mol. IUPAC name: 2,2-dimethyl-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]propan-1-one. InChIKey: DEWYSULLSQVBJV-UHFFFAOYSA-N.
| Molecular formula | C19H26BNO3 |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | 2,2-dimethyl-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]propan-1-one |
| InChIKey | DEWYSULLSQVBJV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=CN3C(=O)C(C)(C)C |
Computed by PubChem (NCBI)