cas: 771-61-9 — see every product listed under this CAS number, including other names
2,3,4,5,6-Pentafluorophenol, 99%, 99% (CAS 771-61-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FD5-5g |
| cas | 771-61-9 |
| size | 5g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 50g | 98.00 Pln | |
| Chemat | 100g | 131.60 Pln | |
| Chemat | 500g | 460.80 Pln | |
| Chemat | 250g | 232.40 Pln | |
| Chemat | 1kg | 827.60 Pln | |
| Chemat | 5kg | 4156.80 Pln | |
| Chemat | 10kg | price on request |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2,3,4,5,6-pentafluorophenol (CAS 771-61-9) is a chemical compound with the molecular formula C6HF5O and a molecular weight of 184.06 g/mol. IUPAC name: 2,3,4,5,6-pentafluorophenol. InChIKey: XBNGYFFABRKICK-UHFFFAOYSA-N.
| Molecular formula | C6HF5O |
|---|---|
| Molecular weight | 184.06 g/mol |
| IUPAC name | 2,3,4,5,6-pentafluorophenol |
| InChIKey | XBNGYFFABRKICK-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)O |
Computed by PubChem (NCBI)