2,3,4,5-Tetrachloroanisole, 95%
cas: 938-86-3 — see every product listed under this CAS number, including other names
2,3,4,5-Tetrachloroanisole, 95% (CAS 938-86-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A540849-250mg |
| cas | 938-86-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 915.50 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 980.79 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1134.80 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 5g | 2101.36 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1,2,3,4-tetrachloro-5-methoxybenzene (CAS 938-86-3) is a chemical compound with the molecular formula C7H4Cl4O and a molecular weight of 245.9 g/mol. IUPAC name: 1,2,3,4-tetrachloro-5-methoxybenzene. InChIKey: FUUHMSUPRUNWRQ-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl4O |
|---|---|
| Molecular weight | 245.9 g/mol |
| IUPAC name | 1,2,3,4-tetrachloro-5-methoxybenzene |
| InChIKey | FUUHMSUPRUNWRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
1,2,3,4-Tetrachloro-5-methoxybenzene, Anisole, 2,3,4,5-tetrachloro-, Benzene, 1,2,3,4-tetrachloro-5-methoxy-, FUUHMSUPRUNWRQ-UHFFFAOYSA-N, 1,2,3,4-Tetrachloro-5-methoxy-benzene, tetrachloroanisole, 2,3,4,5-Tetrachloro-1-methoxybenzene, 1-Methoxy-2,3,4,5-tetrachloro-5benzene, 1,2,3,4-Tetrachloro-5-methoxybenzene #, 2,3,4,5-Tetrachloroanisole 10 mug/mL in Isooctane