cas: 16583-06-5 — see every product listed under this CAS number, including other names
2,3,4,5-Tetrafluorobenzaldehyde, 97%, 97% (CAS 16583-06-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FDH-100mg |
| cas | 16583-06-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 645.20 Pln | |
| Chemat | 25g | 2891.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3,4,5-tetrafluorobenzaldehyde (CAS 16583-06-5) is a chemical compound with the molecular formula C7H2F4O and a molecular weight of 178.08 g/mol. IUPAC name: 2,3,4,5-tetrafluorobenzaldehyde. InChIKey: UPJHEKIKCNDMEX-UHFFFAOYSA-N.
| Molecular formula | C7H2F4O |
|---|---|
| Molecular weight | 178.08 g/mol |
| IUPAC name | 2,3,4,5-tetrafluorobenzaldehyde |
| InChIKey | UPJHEKIKCNDMEX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)C=O |
Computed by PubChem (NCBI)