2,3,4,5-Tetrafluorobenzene-1-sulfonyl chloride, 98%
cas: 591249-21-7 — see every product listed under this CAS number, including other names
2,3,4,5-Tetrafluorobenzene-1-sulfonyl chloride, 98% (CAS 591249-21-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12HKYB-50mg |
| cas | 591249-21-7 |
| size | 50mg |
| availability | 3g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 453.20 Pln | |
| Chemat | 100mg | 688.40 Pln | |
| Chemat | 250mg | 1038.80 Pln | |
| Chemat | 1g | 2022.80 Pln | |
| Fluorochem | 50mg | 591.48 Pln | |
| Fluorochem | 100mg | 914.28 Pln | |
| Fluorochem | 250mg | 1382.86 Pln | |
| Fluorochem | 1g | 2700.11 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3,4,5-tetrafluorobenzenesulfonyl chloride (CAS 591249-21-7) is a chemical compound with the molecular formula C6HClF4O2S and a molecular weight of 248.58 g/mol. IUPAC name: 2,3,4,5-tetrafluorobenzenesulfonyl chloride. InChIKey: RLVBQZRXFSRXFL-UHFFFAOYSA-N.
| Molecular formula | C6HClF4O2S |
|---|---|
| Molecular weight | 248.58 g/mol |
| IUPAC name | 2,3,4,5-tetrafluorobenzenesulfonyl chloride |
| InChIKey | RLVBQZRXFSRXFL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1S(=O)(=O)Cl)F)F)F)F |
Computed by PubChem (NCBI)