2,3,4,5-Tetrakis(4-(tert-butyl)phenyl)cyclopenta-2,4-dien-1-one, 95%
cas: 196505-83-6 — see every product listed under this CAS number, including other names
2,3,4,5-Tetrakis(4-(tert-butyl)phenyl)cyclopenta-2,4-dien-1-one, 95% (CAS 196505-83-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1868911-50mg |
| cas | 196505-83-6 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 331.44 Pln | |
| Ambeed | 250mg | 865.44 Pln | |
| Ambeed | 1g | 2200.44 Pln | |
| Chemat | 50mg | 333.20 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 894.80 Pln | |
| Chemat | 1g | 2301.20 Pln | |
| BLDpharm | 50mg | 347.68 Pln | |
| BLDpharm | 100mg | 542.06 Pln | |
| BLDpharm | 250mg | 925.25 Pln | |
| BLDpharm | 1g | 2369.19 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,3,4,5-tetrakis(4-tert-butylphenyl)cyclopenta-2,4-dien-1-one (CAS 196505-83-6) is a chemical compound with the molecular formula C45H52O and a molecular weight of 608.9 g/mol. IUPAC name: 2,3,4,5-tetrakis(4-tert-butylphenyl)cyclopenta-2,4-dien-1-one. InChIKey: JJWIUVKBQWRIJK-UHFFFAOYSA-N.
| Molecular formula | C45H52O |
|---|---|
| Molecular weight | 608.9 g/mol |
| IUPAC name | 2,3,4,5-tetrakis(4-tert-butylphenyl)cyclopenta-2,4-dien-1-one |
| InChIKey | JJWIUVKBQWRIJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=C(C(=O)C(=C2C3=CC=C(C=C3)C(C)(C)C)C4=CC=C(C=C4)C(C)(C)C)C5=CC=C(C=C5)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
2,3,4,5-Tetrakis(4-tert-butylphenyl)cyclopenta-2,4-dien-1-one, 2,3,4,5-tetrakis(4-(tert-butyl)phenyl)cyclopenta-2,4-dien-1-one, 2,4-Cyclopentadien-1-one, 2,3,4,5-tetrakis[4-(1,1-dimethylethyl)phenyl]-, 2,3,4,5-Tetrakis[4-(tert-butyl)phenyl]cyclopenta-2,4-dienone, 2,3,4,5-tetrakis-[4-(tert-butyl)phenyl]-2,4-cyclopentadien-1-one