cas: 121238-27-5 — see every product listed under this CAS number, including other names
2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl trichloroacetimidate 95% (CAS 121238-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A770657-100mg |
| cas | 121238-27-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 754.19 Pln | |
| Ambeed | 1g | 1638.62 Pln | |
| Ambeed | 5g | 4787.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A770657 |
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (CAS 121238-27-5) is a chemical compound with the molecular formula C16H20Cl3NO10 and a molecular weight of 492.7 g/mol. IUPAC name: [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate. InChIKey: IBUZGVQIKARDAF-PEBLQZBPSA-N.
| Molecular formula | C16H20Cl3NO10 |
|---|---|
| Molecular weight | 492.7 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| InChIKey | IBUZGVQIKARDAF-PEBLQZBPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)