cas: 86520-63-0 — see every product listed under this CAS number, including other names
2,3,4,6-Tetra-O-acetyl-α-glucopyranosyl 2,2,2-trichloroacetimidate, 98%, 98% (CAS 86520-63-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FDU-100mg |
| cas | 86520-63-0 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 957.20 Pln | |
| Chemat | 25g | 1994.00 Pln | |
| Chemat | 50g | 3851.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (CAS 86520-63-0) is a chemical compound with the molecular formula C16H20Cl3NO10 and a molecular weight of 492.7 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate. InChIKey: IBUZGVQIKARDAF-MBJXGIAVSA-N.
| Molecular formula | C16H20Cl3NO10 |
|---|---|
| Molecular weight | 492.7 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| InChIKey | IBUZGVQIKARDAF-MBJXGIAVSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)