cas: 92420-89-8 — see every product listed under this CAS number, including other names
2,3,4-Tri-o-acetyl-alpha-d-glucuronic acid methyl ester, trichloroacetimidate, 95%, 95% (CAS 92420-89-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143X8-100mg |
| cas | 92420-89-8 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 100g | 3851.60 Pln | |
| Chemat | 250g | 5958.80 Pln | |
| Chemat | 500g | 8246.40 Pln | |
| Chemat | 1kg | 13317.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate (CAS 92420-89-8) is a chemical compound with the molecular formula C15H18Cl3NO10 and a molecular weight of 478.7 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate. InChIKey: KWNIVSQDHXVNAL-HKLXJQGRSA-N.
| Molecular formula | C15H18Cl3NO10 |
|---|---|
| Molecular weight | 478.7 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
| InChIKey | KWNIVSQDHXVNAL-HKLXJQGRSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@@H]([C@@H]1OC(=O)C)OC(=N)C(Cl)(Cl)Cl)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)