cas: 34732-09-7 — see every product listed under this CAS number, including other names
2,3,4-Trichlorobenzene-1-sulfonyl chloride, 97% (CAS 34732-09-7) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | TL00422EA |
| cas | 34732-09-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 10g | 201.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,3,4-trichlorobenzenesulfonyl chloride (CAS 34732-09-7) is a chemical compound with the molecular formula C6H2Cl4O2S and a molecular weight of 280.0 g/mol. IUPAC name: 2,3,4-trichlorobenzenesulfonyl chloride. InChIKey: JDAJYNHGBUXIKS-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl4O2S |
|---|---|
| Molecular weight | 280.0 g/mol |
| IUPAC name | 2,3,4-trichlorobenzenesulfonyl chloride |
| InChIKey | JDAJYNHGBUXIKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1S(=O)(=O)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)