2,3,5,6-Tetrachloro-1,4-benzenediol, 98%, 98%
cas: 87-87-6 — see every product listed under this CAS number, including other names
2,3,5,6-Tetrachloro-1,4-benzenediol, 98%, 98% (CAS 87-87-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 75g, 100g, 200g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115G2W-1g |
| cas | 87-87-6 |
| size | 1g |
| availability | 2000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 50g | 184.40 Pln | |
| Chemat | 75g | 246.80 Pln | |
| Chemat | 100g | 290.00 Pln | |
| Chemat | 200g | 491.60 Pln | |
| Chemat | 300g | 698.00 Pln | |
| Chemat | 500g | 921.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tetrachlorohydroquinone is a tetrachlorobenzene that is 1,2,4,5-tetrachlorobenzene in which the hydrogens at positions 3 and 6 are replaced by hydroxy groups. It is a member of chlorohydroquinones and a tetrachlorobenzene. It is functionally related to a 1,2,4,5-tetrachlorobenzene. It is a conjugate acid of a 2,3,5,6-tetrachlorobenzene-1,4-bis(olate).
Source: ChEBI
| Molecular formula | C6H2Cl4O2 |
|---|---|
| Molecular weight | 247.9 g/mol |
| IUPAC name | 2,3,5,6-tetrachlorobenzene-1,4-diol |
| InChIKey | STOSPPMGXZPHKP-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)O)Cl)Cl)O |
Computed by PubChem (NCBI)