cas: 5216-22-8 — see every product listed under this CAS number, including other names
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzoic acid, 97%, 97% (CAS 5216-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DFL6-1g |
| cas | 5216-22-8 |
| size | 1g |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1269.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzoic acid (CAS 5216-22-8) is a chemical compound with the molecular formula C8HF7O2 and a molecular weight of 262.08 g/mol. IUPAC name: 2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzoic acid. InChIKey: VSDRQVXQXFLZEG-UHFFFAOYSA-N.
| Molecular formula | C8HF7O2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzoic acid |
| InChIKey | VSDRQVXQXFLZEG-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)C(F)(F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)