cas: 19842-76-3 — see every product listed under this CAS number, including other names
2,3,5,6-Tetrafluorobenzaldehyde (CAS 19842-76-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009870-1G |
| cas | 19842-76-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 378.01 Pln | |
| Fluorochem | 10g | 685.19 Pln | |
| Fluorochem | 25g | 1174.60 Pln | |
| Fluorochem | 100g | 1611.95 Pln |
| delivery time | 3-4 weeks |
|---|
2,3,5,6-tetrafluorobenzaldehyde (CAS 19842-76-3) is a chemical compound with the molecular formula C7H2F4O and a molecular weight of 178.08 g/mol. IUPAC name: 2,3,5,6-tetrafluorobenzaldehyde. InChIKey: YIRYOMXPMOLQSO-UHFFFAOYSA-N.
| Molecular formula | C7H2F4O |
|---|---|
| Molecular weight | 178.08 g/mol |
| IUPAC name | 2,3,5,6-tetrafluorobenzaldehyde |
| InChIKey | YIRYOMXPMOLQSO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)C=O)F)F |
Computed by PubChem (NCBI)