cas: 238403-46-8 — see every product listed under this CAS number, including other names
2,3,5-Trifluorobenzamide (CAS 238403-46-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007955-1G |
| cas | 238403-46-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 700.81 Pln |
| delivery time | 2-3 weeks |
|---|
2,3,5-trifluorobenzamide (CAS 238403-46-8) is a chemical compound with the molecular formula C7H4F3NO and a molecular weight of 175.11 g/mol. IUPAC name: 2,3,5-trifluorobenzamide. InChIKey: CHWOHKUVNHFOML-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO |
|---|---|
| Molecular weight | 175.11 g/mol |
| IUPAC name | 2,3,5-trifluorobenzamide |
| InChIKey | CHWOHKUVNHFOML-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)N)F)F)F |
Computed by PubChem (NCBI)