cas: 1644-68-4 — see every product listed under this CAS number, including other names
2,3-Bis(trifluoromethyl)pyridine (CAS 1644-68-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010402-250MG |
| cas | 1644-68-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 502.97 Pln |
| delivery time | 2-3 weeks |
|---|
2,3-bis(trifluoromethyl)pyridine (CAS 1644-68-4) is a chemical compound with the molecular formula C7H3F6N and a molecular weight of 215.10 g/mol. IUPAC name: 2,3-bis(trifluoromethyl)pyridine. InChIKey: RRNXYHYDSDAOFW-UHFFFAOYSA-N.
| Molecular formula | C7H3F6N |
|---|---|
| Molecular weight | 215.10 g/mol |
| IUPAC name | 2,3-bis(trifluoromethyl)pyridine |
| InChIKey | RRNXYHYDSDAOFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)