CAS 13243-65-7 appears in our catalog under these names: 2,3-DIBROMO-1,4-NAPHTHOQUINONE, 2,3-Dibromonaphthalene-1,4-dione, 95+%, 95+%, 2,3-Dibromonaphthalene-1,4-dione, 98%. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25G, 1g, 5g, 10g, 100g.
2,3-dibromonaphthalene-1,4-dione (CAS 13243-65-7) is a chemical compound with the molecular formula C10H4Br2O2 and a molecular weight of 315.94 g/mol. IUPAC name: 2,3-dibromonaphthalene-1,4-dione. InChIKey: PSMABVOYZJWFBV-UHFFFAOYSA-N.
| Molecular formula | C10H4Br2O2 |
|---|---|
| Molecular weight | 315.94 g/mol |
| IUPAC name | 2,3-dibromonaphthalene-1,4-dione |
| InChIKey | PSMABVOYZJWFBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)Br)Br |
Computed by PubChem (NCBI)