cas: 117-80-6 — see every product listed under this CAS number, including other names
2,3-Dichloro-1,4-naphthoquinone, >95.0%(GC) (CAS 117-80-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0384-25G |
| cas | 117-80-6 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 188.68 Pln | |
| TCI | 500g | 513.21 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
2,3-dichloronaphthalene-1,4-dione (CAS 117-80-6) is a chemical compound with the molecular formula C10H4Cl2O2 and a molecular weight of 227.04 g/mol. IUPAC name: 2,3-dichloronaphthalene-1,4-dione. InChIKey: SVPKNMBRVBMTLB-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2O2 |
|---|---|
| Molecular weight | 227.04 g/mol |
| IUPAC name | 2,3-dichloronaphthalene-1,4-dione |
| InChIKey | SVPKNMBRVBMTLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)