cas: 1073353-78-2 — see every product listed under this CAS number, including other names
2,3-Dichloropyridine-4-boronic Acid Pinacol Ester, 97%, 97% (CAS 1073353-78-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WHR-250mg |
| cas | 1073353-78-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 1058.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1073353-78-2) is a chemical compound with the molecular formula C11H14BCl2NO2 and a molecular weight of 274.0 g/mol. IUPAC name: 2,3-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: LRQNNFMOVWWIHA-UHFFFAOYSA-N.
| Molecular formula | C11H14BCl2NO2 |
|---|---|
| Molecular weight | 274.0 g/mol |
| IUPAC name | 2,3-dichloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | LRQNNFMOVWWIHA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)Cl)Cl |
Computed by PubChem (NCBI)