cas: 1003708-24-4 — see every product listed under this CAS number, including other names
2,3-Difluoro-4-bromonitrobenzene 98% (CAS 1003708-24-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148993-250mg |
| cas | 1003708-24-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 720.81 Pln | |
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 25g | 2656.56 Pln | |
| Ambeed | 100g | 9125.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148993 |
1-bromo-2,3-difluoro-4-nitrobenzene (CAS 1003708-24-4) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 1-bromo-2,3-difluoro-4-nitrobenzene. InChIKey: GXNBBNIEEJTQST-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO2 |
|---|---|
| Molecular weight | 237.99 g/mol |
| IUPAC name | 1-bromo-2,3-difluoro-4-nitrobenzene |
| InChIKey | GXNBBNIEEJTQST-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)F)Br |
Computed by PubChem (NCBI)