cas: 2377610-80-3 — see every product listed under this CAS number, including other names
2,3-Difluoro-5-nitrophenylboronic acid pinacol ester, 98%, 98% (CAS 2377610-80-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JJDV-1g |
| cas | 2377610-80-3 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 606.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,3-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2377610-80-3) is a chemical compound with the molecular formula C12H14BF2NO4 and a molecular weight of 285.05 g/mol. IUPAC name: 2-(2,3-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MGQAXTCSCPDQEJ-UHFFFAOYSA-N.
| Molecular formula | C12H14BF2NO4 |
|---|---|
| Molecular weight | 285.05 g/mol |
| IUPAC name | 2-(2,3-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MGQAXTCSCPDQEJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)