Products 109341-49-3
CAS 109341-49-3 appears in our catalog under these names: 2,3-Dihydro-1H-cyclopenta[b]naphthalen-1-one, 95%, 95%, 2,3-DIHYDRO-1H-CYCLOPENTA[B]NAPHTHALEN-1-ONE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,2-dihydrocyclopenta[b]naphthalen-3-one (CAS 109341-49-3) is a chemical compound with the molecular formula C13H10O and a molecular weight of 182.22 g/mol. IUPAC name: 1,2-dihydrocyclopenta[b]naphthalen-3-one. InChIKey: LWQSMXIFHVPMDA-UHFFFAOYSA-N.
| Molecular formula | C13H10O |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 1,2-dihydrocyclopenta[b]naphthalen-3-one |
| InChIKey | LWQSMXIFHVPMDA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC3=CC=CC=C3C=C21 |
Computed by PubChem (NCBI)