Products 2771132-16-0
CAS 2771132-16-0 is the registry number for 1,1-dioxo-3,5-dihydro-2H-4,1benzoxathiepine-8-carboxylic acid, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1,1-dioxo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine-8-carboxylic acid (CAS 2771132-16-0) is a chemical compound with the molecular formula C10H10O5S and a molecular weight of 242.25 g/mol. IUPAC name: 1,1-dioxo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine-8-carboxylic acid. InChIKey: DNUKYNHIRQKJHL-UHFFFAOYSA-N.
| Molecular formula | C10H10O5S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 1,1-dioxo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine-8-carboxylic acid |
| InChIKey | DNUKYNHIRQKJHL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(CO1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)