cas: 15945-07-0 — see every product listed under this CAS number, including other names
2,4,5-Trichlorobenzenesulfonyl Chloride, >98.0%(GC)(T) (CAS 15945-07-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B0247-25G |
| cas | 15945-07-0 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 296.86 Pln | |
| TCI | 500g | 1826.12 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,4,5-trichlorobenzenesulfonyl chloride (CAS 15945-07-0) is a chemical compound with the molecular formula C6H2Cl4O2S and a molecular weight of 280.0 g/mol. IUPAC name: 2,4,5-trichlorobenzenesulfonyl chloride. InChIKey: WNVVRCKTQSCPAC-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl4O2S |
|---|---|
| Molecular weight | 280.0 g/mol |
| IUPAC name | 2,4,5-trichlorobenzenesulfonyl chloride |
| InChIKey | WNVVRCKTQSCPAC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)