CAS 16732-09-5 appears in our catalog under these names: Caproic acid 2,4,6-tribromophenyl ester, 95%, 2,4,6-Tribromophenyl caproate, 95+%, 2,4,6-Tribromophenyl caproate/ 98.24% (existing batch purity), 2,4,6–Tribromophenyl caproate, 2,4,6-Tribromophenyl Hexanoate, >97.0%(GC). Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, TCI. Available pack sizes: 25g, 1g, 5g, 500mg, 10mM (in 1ml dmso), 200mg, 10mM/1mL, 5 g.
(2,4,6-tribromophenyl) hexanoate (CAS 16732-09-5) is a chemical compound with the molecular formula C12H13Br3O2 and a molecular weight of 428.94 g/mol. IUPAC name: (2,4,6-tribromophenyl) hexanoate. InChIKey: WKADNUIXFNFRSW-UHFFFAOYSA-N.
| Molecular formula | C12H13Br3O2 |
|---|---|
| Molecular weight | 428.94 g/mol |
| IUPAC name | (2,4,6-tribromophenyl) hexanoate |
| InChIKey | WKADNUIXFNFRSW-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)OC1=C(C=C(C=C1Br)Br)Br |
Computed by PubChem (NCBI)