CAS 14348-40-4 appears in our catalog under these names: TBHBA, 2,4,6-Tribromo-3-hydroxybenzoic acid, 97% , 3-Hydroxy-2,4,6-tribromobenzoic aicd, 3-Hydroxy-2,4,6-tribromobenzoic acid, 97%, 3-Hydroxy-2,4,6-tribromobenzoic acid, 98.00%. Offered by: TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 500mg, 5g, 25g, 10g, 1g, 50g, 250g, 100g.
2,4,6-tribromo-3-hydroxybenzoic acid (CAS 14348-40-4) is a chemical compound with the molecular formula C7H3Br3O3 and a molecular weight of 374.81 g/mol. IUPAC name: 2,4,6-tribromo-3-hydroxybenzoic acid. InChIKey: YDBHVMTTYXWHLI-UHFFFAOYSA-N.
| Molecular formula | C7H3Br3O3 |
|---|---|
| Molecular weight | 374.81 g/mol |
| IUPAC name | 2,4,6-tribromo-3-hydroxybenzoic acid |
| InChIKey | YDBHVMTTYXWHLI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)Br)C(=O)O)Br |
Computed by PubChem (NCBI)