2,4,6-Tribromophenyl methacrylate, 97%
cas: 37721-71-4 — see every product listed under this CAS number, including other names
2,4,6-Tribromophenyl methacrylate, 97% (CAS 37721-71-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F623907-10G |
| cas | 37721-71-4 |
| size | 10g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 1049.65 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 1015.62 Pln | |
| Ambeed | 25g | 1966.81 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 636.47 Pln | |
| BLDpharm | 10g | 1091.86 Pln | |
| BLDpharm | 25g | 2113.72 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 612.30 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2,4,6-tribromophenyl) 2-methylprop-2-enoate (CAS 37721-71-4) is a chemical compound with the molecular formula C10H7Br3O2 and a molecular weight of 398.87 g/mol. IUPAC name: (2,4,6-tribromophenyl) 2-methylprop-2-enoate. InChIKey: HAYWJKBZHDIUPU-UHFFFAOYSA-N.
| Molecular formula | C10H7Br3O2 |
|---|---|
| Molecular weight | 398.87 g/mol |
| IUPAC name | (2,4,6-tribromophenyl) 2-methylprop-2-enoate |
| InChIKey | HAYWJKBZHDIUPU-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=C(C=C(C=C1Br)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-Tribromophenyl methacrylate, 2-Propenoic acid, 2-methyl-, 2,4,6-tribromophenyl ester, HAYWJKBZHDIUPU-UHFFFAOYSA-N, (2,4,6-tribromophenyl) 2-methylprop-2-enoate, 2,4,6-tribromophenyl 2-methylprop-2-enoate, 2,4,6-Tribromophenylmethacrylate, TRIBROMONEOPENTYL METHACRYLATE, 2,4,6-Tribromophenyl methacrylate, 98%, C10H7Br3O2, s12167