cas: 3029-64-9 — see every product listed under this CAS number, including other names
2,4,6-Trichloro-5-cyanopyrimidine 98% (CAS 3029-64-9) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A425559-500g |
| cas | 3029-64-9 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 22275.50 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 10g | 882.12 Pln | |
| Ambeed | 25g | 1744.31 Pln | |
| Ambeed | 100g | 5621.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A425559 |
2,4,6-trichloropyrimidine-5-carbonitrile (CAS 3029-64-9) is a chemical compound with the molecular formula C5Cl3N3 and a molecular weight of 208.43 g/mol. IUPAC name: 2,4,6-trichloropyrimidine-5-carbonitrile. InChIKey: IAJCAZVXGKGAQK-UHFFFAOYSA-N.
| Molecular formula | C5Cl3N3 |
|---|---|
| Molecular weight | 208.43 g/mol |
| IUPAC name | 2,4,6-trichloropyrimidine-5-carbonitrile |
| InChIKey | IAJCAZVXGKGAQK-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(N=C(N=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)