cas: 40381-91-7 — see every product listed under this CAS number, including other names
2,4,6-Trichloronicotinonitrile 95% (CAS 40381-91-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A957402-100mg |
| cas | 40381-91-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1432.81 Pln | |
| Ambeed | 5g | 5204.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A957402 |
2,4,6-trichloropyridine-3-carbonitrile (CAS 40381-91-7) is a chemical compound with the molecular formula C6HCl3N2 and a molecular weight of 207.4 g/mol. IUPAC name: 2,4,6-trichloropyridine-3-carbonitrile. InChIKey: GCNVFPGCHKJKJK-UHFFFAOYSA-N.
| Molecular formula | C6HCl3N2 |
|---|---|
| Molecular weight | 207.4 g/mol |
| IUPAC name | 2,4,6-trichloropyridine-3-carbonitrile |
| InChIKey | GCNVFPGCHKJKJK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)C#N)Cl |
Computed by PubChem (NCBI)