cas: 93416-51-4 — see every product listed under this CAS number, including other names
2,4,6-Trichloropyrimidine-5-carboxylic acid 97% (CAS 93416-51-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754518-100mg |
| cas | 93416-51-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A754518 |
2,4,6-trichloropyrimidine-5-carboxylic acid (CAS 93416-51-4) is a chemical compound with the molecular formula C5HCl3N2O2 and a molecular weight of 227.43 g/mol. IUPAC name: 2,4,6-trichloropyrimidine-5-carboxylic acid. InChIKey: WYOSARQXNFQQIG-UHFFFAOYSA-N.
| Molecular formula | C5HCl3N2O2 |
|---|---|
| Molecular weight | 227.43 g/mol |
| IUPAC name | 2,4,6-trichloropyrimidine-5-carboxylic acid |
| InChIKey | WYOSARQXNFQQIG-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)