cas: 39085-59-1 — see every product listed under this CAS number, including other names
2,4,6-Triisopropylbenzenesulfonyl hydrazide, 97%, 97% (CAS 39085-59-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114306-250mg |
| cas | 39085-59-1 |
| size | 250mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 299.60 Pln | |
| Chemat | 50g | 534.80 Pln | |
| Chemat | 100g | 990.80 Pln | |
| Chemat | 250g | 2267.60 Pln | |
| Chemat | 500g | 4440.00 Pln | |
| Chemat | 1kg | 5930.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4,6-tri(propan-2-yl)benzenesulfonohydrazide (CAS 39085-59-1) is a chemical compound with the molecular formula C15H26N2O2S and a molecular weight of 298.4 g/mol. IUPAC name: 2,4,6-tri(propan-2-yl)benzenesulfonohydrazide. InChIKey: UGRVYFQFDZRNMQ-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O2S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 2,4,6-tri(propan-2-yl)benzenesulfonohydrazide |
| InChIKey | UGRVYFQFDZRNMQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)S(=O)(=O)NN)C(C)C |
Computed by PubChem (NCBI)