CAS 57199-00-5 appears in our catalog under these names: 2,4,6-Triisopropylbenzoyl chloride, 98%, 2,4,6-Triisopropylbenzoyl chloride, 98+% , 2,4,6-TRIISOPROPYLBENZOYL CHLORIDE, 97%, 2,4,6-Triisopropylbenzoylchloride, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 100g, 250mg.
2,4,6-tri(propan-2-yl)benzoyl chloride (CAS 57199-00-5) is a chemical compound with the molecular formula C16H23ClO and a molecular weight of 266.80 g/mol. IUPAC name: 2,4,6-tri(propan-2-yl)benzoyl chloride. InChIKey: OSKNTKJPGKHDHV-UHFFFAOYSA-N.
| Molecular formula | C16H23ClO |
|---|---|
| Molecular weight | 266.80 g/mol |
| IUPAC name | 2,4,6-tri(propan-2-yl)benzoyl chloride |
| InChIKey | OSKNTKJPGKHDHV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C(=O)Cl)C(C)C |
Computed by PubChem (NCBI)