cas: 135159-25-0 — see every product listed under this CAS number, including other names
2,4,6-Trimethoxyphenylboronic acid 98% (CAS 135159-25-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A843509-250mg |
| cas | 135159-25-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1160.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A843509 |
(2,4,6-trimethoxyphenyl)boronic acid (CAS 135159-25-0) is a chemical compound with the molecular formula C9H13BO5 and a molecular weight of 212.01 g/mol. IUPAC name: (2,4,6-trimethoxyphenyl)boronic acid. InChIKey: PKLRXZVPEQJTTJ-UHFFFAOYSA-N.
| Molecular formula | C9H13BO5 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | (2,4,6-trimethoxyphenyl)boronic acid |
| InChIKey | PKLRXZVPEQJTTJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)OC)OC)(O)O |
Computed by PubChem (NCBI)