CAS 2454396-80-4 appears in our catalog under these names: 2,4,7-Trichloro-8-fluoropyrido[4,3-d]pyrimidine, 99.90%, 2,4,7-Trichloro-8-fluoropyrido[4,3-d]pyrimidine, 95%. Offered by: MedChemExpress, Fluorochem. Available pack sizes: 50 g, 100 g, 1 g, 25 g, 10 g, 5 g, 1g, 5g.
2,4,7-trichloro-8-fluoropyrido[4,3-d]pyrimidine (CAS 2454396-80-4) is a chemical compound with the molecular formula C7HCl3FN3 and a molecular weight of 252.5 g/mol. IUPAC name: 2,4,7-trichloro-8-fluoropyrido[4,3-d]pyrimidine. InChIKey: ILTXDPMYCUSDQV-UHFFFAOYSA-N.
| Molecular formula | C7HCl3FN3 |
|---|---|
| Molecular weight | 252.5 g/mol |
| IUPAC name | 2,4,7-trichloro-8-fluoropyrido[4,3-d]pyrimidine |
| InChIKey | ILTXDPMYCUSDQV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=N1)Cl)F)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)