2,4-Bis(4-bromophenyl)-6-phenyl-1,3,5-triazine, 98%
cas: 137726-53-5 — see every product listed under this CAS number, including other names
2,4-Bis(4-bromophenyl)-6-phenyl-1,3,5-triazine, 98% (CAS 137726-53-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1728289-100mg |
| cas | 137726-53-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1499.56 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1499.60 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1608.35 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,4-bis(4-bromophenyl)-6-phenyl-1,3,5-triazine (CAS 137726-53-5) is a chemical compound with the molecular formula C21H13Br2N3 and a molecular weight of 467.2 g/mol. IUPAC name: 2,4-bis(4-bromophenyl)-6-phenyl-1,3,5-triazine. InChIKey: LPAIMIDPVLVBKB-UHFFFAOYSA-N.
| Molecular formula | C21H13Br2N3 |
|---|---|
| Molecular weight | 467.2 g/mol |
| IUPAC name | 2,4-bis(4-bromophenyl)-6-phenyl-1,3,5-triazine |
| InChIKey | LPAIMIDPVLVBKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)