2,4-Bis(benzyloxy)-5-isopropylbenzoic acid, 97%
cas: 909871-48-3 — see every product listed under this CAS number, including other names
2,4-Bis(benzyloxy)-5-isopropylbenzoic acid, 97% (CAS 909871-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1924471-100mg |
| cas | 909871-48-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 765.31 Pln | |
| Ambeed | 250mg | 1377.19 Pln | |
| Ambeed | 1g | 3168.31 Pln | |
| Ambeed | 5g | 7696.19 Pln | |
| BLDpharm | 100mg | 819.74 Pln | |
| BLDpharm | 250mg | 1480.61 Pln | |
| BLDpharm | 1g | 3407.71 Pln | |
| BLDpharm | 5g | 8289.33 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,4-bis(phenylmethoxy)-5-propan-2-ylbenzoic acid (CAS 909871-48-3) is a chemical compound with the molecular formula C24H24O4 and a molecular weight of 376.4 g/mol. IUPAC name: 2,4-bis(phenylmethoxy)-5-propan-2-ylbenzoic acid. InChIKey: UUEGRIYBROTBQL-UHFFFAOYSA-N.
| Molecular formula | C24H24O4 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 2,4-bis(phenylmethoxy)-5-propan-2-ylbenzoic acid |
| InChIKey | UUEGRIYBROTBQL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Bis(benzyloxy)-5-isopropylbenzoic acid, 2,4-dibenzyloxy-5-isopropylbenzoic acid, Benzoic acid, 5-(1-methylethyl)-2,4-bis(phenylmethoxy)-, UUEGRIYBROTBQL-UHFFFAOYSA-N, 2,4-Bis-benzyloxy-5-isopropylbenzoic acid, 2,4-Bis-benzyloxy-5-isoproyl-benzoic acid, 2,4-Bis-benzyloxy-5-isopropyl-benzoic acid