CAS 497181-20-1 appears in our catalog under these names: 2,4-Dibromo-6-fluorobenzoyl chloride, 95%, 2,4-Dibromo-6-fluorobenzoyl chloride, 97%, 2,4-Dibromo-6-fluorobenzoyl chloride, ≥95%, ≥95%, 2,4-DIBROMO-6-FLUOROBENZOYL CHLORIDE, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2,4-dibromo-6-fluorobenzoyl chloride (CAS 497181-20-1) is a chemical compound with the molecular formula C7H2Br2ClFO and a molecular weight of 316.35 g/mol. IUPAC name: 2,4-dibromo-6-fluorobenzoyl chloride. InChIKey: JHXLZDKMZOGVLP-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2ClFO |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | 2,4-dibromo-6-fluorobenzoyl chloride |
| InChIKey | JHXLZDKMZOGVLP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)Cl)Br)Br |
Computed by PubChem (NCBI)