cas: 436096-88-7 — see every product listed under this CAS number, including other names
2,4-Di(piperidin-1-yl)aniline, 95%, 95% (CAS 436096-88-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9C9-100mg |
| cas | 436096-88-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1528.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,4-di(piperidin-1-yl)aniline (CAS 436096-88-7) is a chemical compound with the molecular formula C16H25N3 and a molecular weight of 259.39 g/mol. IUPAC name: 2,4-di(piperidin-1-yl)aniline. InChIKey: CHRDROHURUMVLJ-UHFFFAOYSA-N.
| Molecular formula | C16H25N3 |
|---|---|
| Molecular weight | 259.39 g/mol |
| IUPAC name | 2,4-di(piperidin-1-yl)aniline |
| InChIKey | CHRDROHURUMVLJ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC(=C(C=C2)N)N3CCCCC3 |
Computed by PubChem (NCBI)