CAS 74283-34-4 appears in our catalog under these names: 2,4-Diaminophenol sulfate, 98%, 2,4-Diaminophenol sulfate(1:x), 97%, 2,4–Diaminophenol Sulfate, 2,4-Diaminophenol Sulfate, >98.0%(N), 2,4-Diaminophenol sulfate, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g, 100g, 250mg.
2,4-diaminophenol;sulfuric acid (CAS 74283-34-4) is a chemical compound with the molecular formula C6H10N2O5S and a molecular weight of 222.22 g/mol. IUPAC name: 2,4-diaminophenol;sulfuric acid. InChIKey: JKMWKYDJCPSJSI-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O5S |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | 2,4-diaminophenol;sulfuric acid |
| InChIKey | JKMWKYDJCPSJSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)