cas: 71757-14-7 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-(trifluoromethyl)aniline 96% (CAS 71757-14-7) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A312665-25g |
| cas | 71757-14-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 359.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A312665 |
2,4-dibromo-6-(trifluoromethyl)aniline (CAS 71757-14-7) is a chemical compound with the molecular formula C7H4Br2F3N and a molecular weight of 318.92 g/mol. IUPAC name: 2,4-dibromo-6-(trifluoromethyl)aniline. InChIKey: ZYBKXMTWWFTYKN-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F3N |
|---|---|
| Molecular weight | 318.92 g/mol |
| IUPAC name | 2,4-dibromo-6-(trifluoromethyl)aniline |
| InChIKey | ZYBKXMTWWFTYKN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)Br)Br |
Computed by PubChem (NCBI)