2,4-Dibromo-6-[(cyclohexyl-methyl-amino)-methyl]-phenylamine, 98%, 98%
cas: 611-75-6 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-[(cyclohexyl-methyl-amino)-methyl]-phenylamine, 98%, 98% (CAS 611-75-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 50g, 75g, 200g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OJX-5g |
| cas | 611-75-6 |
| size | 5g |
| availability | 3000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 203.60 Pln | |
| Chemat | 500g | 657.60 Pln | |
| Chemat | 50g | 150.80 Pln | |
| Chemat | 75g | 194.00 Pln | |
| Chemat | 200g | 328.40 Pln | |
| Chemat | 300g | 458.00 Pln | |
| Chemat | 400g | 582.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Bromhexine hydrochloride is a hydrochloride resulting from the reaction of equimolar amounts of bromhexine and hydrogen chloride. It is used as a mucolytic for the treatment of respiratory disorders associated with productive cough (i.e. a cough characterised by the production of sputum). It has a role as a mucolytic. It contains a bromhexine(1+).
Source: ChEBI
| Molecular formula | C14H21Br2ClN2 |
|---|---|
| Molecular weight | 412.59 g/mol |
| IUPAC name | 2,4-dibromo-6-[[cyclohexyl(methyl)amino]methyl]aniline;hydrochloride |
| InChIKey | UCDKONUHZNTQPY-UHFFFAOYSA-N |
| SMILES | CN(CC1=C(C(=CC(=C1)Br)Br)N)C2CCCCC2.Cl |
Computed by PubChem (NCBI)