Products 73087-81-7

CAS 73087-81-7 is the registry number for 2,4-Dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline (CAS 73087-81-7) is a chemical compound with the molecular formula C18H10Br5N and a molecular weight of 639.8 g/mol. IUPAC name: 2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline. InChIKey: VFLKOFGZFZHDEI-UHFFFAOYSA-N.

Identity
Molecular formulaC18H10Br5N
Molecular weight639.8 g/mol
IUPAC name2,4-dibromo-N-(4-bromophenyl)-N-(2,4-dibromophenyl)aniline
InChIKeyVFLKOFGZFZHDEI-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N(C2=C(C=C(C=C2)Br)Br)C3=C(C=C(C=C3)Br)Br)Br

Computed by PubChem (NCBI)