2,4-Dichloro-5-(chlorosulfonyl)benzoic acid 95%
cas: 3740-18-9 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-(chlorosulfonyl)benzoic acid 95% (CAS 3740-18-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A570834-100mg |
| cas | 3740-18-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 670.75 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A570834 |
2,4-dichloro-5-chlorosulfonylbenzoic acid (CAS 3740-18-9) is a chemical compound with the molecular formula C7H3Cl3O4S and a molecular weight of 289.5 g/mol. IUPAC name: 2,4-dichloro-5-chlorosulfonylbenzoic acid. InChIKey: MPUNAIYDVXJQBJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O4S |
|---|---|
| Molecular weight | 289.5 g/mol |
| IUPAC name | 2,4-dichloro-5-chlorosulfonylbenzoic acid |
| InChIKey | MPUNAIYDVXJQBJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dichloro-5-(chlorosulfonyl)benzoic acid, 2,4-Dichloro-5-(chlorosulphonyl)benzoic acid, 2,4-dichloro-5-chlorosulfonyl-benzoic acid, 2,4-dichloro-5-chlorosulfonylbenzoic acid, Furosemide Impurity 41, Benzoic acid, 2,4-dichloro-5-(chlorosulfonyl)-, 2,4-Dichloro-5-chlorosulphonylbenzoic acid, Furosemide Impurity 16, Atropine Mesylate, 5-Chlorosulfonyl-2,4-dichlorobenzoic acid