2,4-Dichloro-5-fluoro-3-nitrobenzoic acid
cas: 106809-14-7 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-fluoro-3-nitrobenzoic acid (CAS 106809-14-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FD67947-50g |
| cas | 106809-14-7 |
| size | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Biosynth | 50g | price on request | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 482.14 Pln | |
| Fluorochem | 250g | 518.59 Pln |
properties
| category | Research Chemicals |
|---|---|
| purity | No data |
| delivery time | 1-2 weeks |
2,4-dichloro-5-fluoro-3-nitrobenzoic acid (CAS 106809-14-7) is a chemical compound with the molecular formula C7H2Cl2FNO4 and a molecular weight of 254.00 g/mol. IUPAC name: 2,4-dichloro-5-fluoro-3-nitrobenzoic acid. InChIKey: PCSAPCNEJUEIGU-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FNO4 |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 2,4-dichloro-5-fluoro-3-nitrobenzoic acid |
| InChIKey | PCSAPCNEJUEIGU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dichloro-5-fluoro-3-nitrobenzoic acid, 2,4-dichloro-5-fluoro-3-nitro-benzoic Acid, C7H2Cl2FNO4, 2,4-dichloro-3-nitro-5-fluoro benzoic acid, Benzoic acid, 2,4-dichloro-5-fluoro-3-nitro-, 2,4-Dichloro-5-fluoro-3-nitrobenzoicAcid, 2,4-Dichloro-3-nitro-5-fluorobenzoicacid, 2,4-Dichloro-5-fluoro-3-nitrobenzoic acid, 97%